About [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate
[3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate (PubChem CID 102434870) has the molecular formula C16H5F7O8S2
and a molecular weight of 522.33 g/mol. Its IUPAC name is [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| PubChem CID | 102434870 |
| Molecular Formula | C16H5F7O8S2 |
| Molecular Weight | 522.33 g/mol |
| Exact Mass | 521.93 |
| IUPAC Name | [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(OS(=O)(=O)C(F)(F)F)c(F)c2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H5F7O8S2/c17-11-9(30-32(26,27)15(18,19)20)5-8-10(14(11)31-33(28,29)16(21,22)23)13(25)7-4-2-1-3-6(7)12(8)24/h1-5H |
| InChIKey | FZJOHMOAXBXJIU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 522.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate?
The IUPAC name of [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate (CID 102434870) is [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate.
What is the SMILES notation for [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate?
The canonical SMILES for [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate is O=C1c2ccccc2C(=O)c2c1cc(OS(=O)(=O)C(F)(F)F)c(F)c2OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate?
The InChIKey is FZJOHMOAXBXJIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H5F7O8S2/c17-11-9(30-32(26,27)15(18,19)20)5-8-10(14(11)31-33(28,29)16(21,22)23)13(25)7-4-2-1-3-6(7)12(8)24/h1-5H.
What are the key properties of [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate?
[3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate has a molecular weight of 522.33 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-9,10-dioxo-4-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate is sourced from PubChem (CID 102434870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).