About 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole
6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole (PubChem CID 102435244) has the molecular formula C19H12FN3S2
and a molecular weight of 365.46 g/mol. Its IUPAC name is 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole |
| PubChem CID | 102435244 |
| Molecular Formula | C19H12FN3S2 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole |
| SMILES | Fc1cccc2c1SCc1cnn(-c3nc(-c4ccccc4)cs3)c1-2 |
| InChI | InChI=1S/C19H12FN3S2/c20-15-8-4-7-14-17-13(10-24-18(14)15)9-21-23(17)19-22-16(11-25-19)12-5-2-1-3-6-12/h1-9,11H,10H2 |
| InChIKey | SEUQUYOGEXTRKO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole?
The IUPAC name of 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole (CID 102435244) is 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole.
What is the SMILES notation for 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole?
The canonical SMILES for 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole is Fc1cccc2c1SCc1cnn(-c3nc(-c4ccccc4)cs3)c1-2.
What is the InChIKey of 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole?
The InChIKey is SEUQUYOGEXTRKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12FN3S2/c20-15-8-4-7-14-17-13(10-24-18(14)15)9-21-23(17)19-22-16(11-25-19)12-5-2-1-3-6-12/h1-9,11H,10H2.
What are the key properties of 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole?
6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole has a molecular weight of 365.46 g/mol, XLogP of 5.41, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-1-(4-phenyl-1,3-thiazol-2-yl)-4H-thiochromeno[3,4-d]pyrazole is sourced from PubChem (CID 102435244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).