C13H14N4O — CID 102435354
3-(azidomethyl)-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 102435354) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(azidomethyl)-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | 3-(azidomethyl)-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 102435354 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-(azidomethyl)-3-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | CC1(CN=[N+]=[N-])C(=O)N2CCCc3cccc1c32 |
| InChI | InChI=1S/C13H14N4O/c1-13(8-15-16-14)10-6-2-4-9-5-3-7-17(11(9)10)12(13)18/h2,4,6H,3,5,7-8H2,1H3 |
| InChIKey | JTICVHCXRAYCDM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|