methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate

C14H15NO3 — CID 10243590

IUPACmethyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate
SMILESCOC(=O)C1=CN(Cc2ccccc2)C(=O)CC1
InChIInChI=1S/C14H15NO3/c1-18-14(17)12-7-8-13(16)15(10-12)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3
InChIKeyMDGYQYIBDUHPHC-UHFFFAOYSA-N
MW245.28 g/mol
LogP1.87
Rot. Bonds3

About methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate

methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate (PubChem CID 10243590) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate.

Molecular Properties

Compound Namemethyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate
PubChem CID10243590
Molecular FormulaC14H15NO3
Molecular Weight245.28 g/mol
Exact Mass245.11
IUPAC Namemethyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate
SMILESCOC(=O)C1=CN(Cc2ccccc2)C(=O)CC1
InChIInChI=1S/C14H15NO3/c1-18-14(17)12-7-8-13(16)15(10-12)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3
InChIKeyMDGYQYIBDUHPHC-UHFFFAOYSA-N
XLogP1.87
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.28
LogP ≤ 51.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate?
The IUPAC name of methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate (CID 10243590) is methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate.
What is the SMILES notation for methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate?
The canonical SMILES for methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate is COC(=O)C1=CN(Cc2ccccc2)C(=O)CC1.
What is the InChIKey of methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate?
The InChIKey is MDGYQYIBDUHPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-18-14(17)12-7-8-13(16)15(10-12)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3.
What are the key properties of methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate?
methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate has a molecular weight of 245.28 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-benzyl-2-oxo-3,4-dihydropyridine-5-carboxylate is sourced from PubChem (CID 10243590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).