About 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane
8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane (PubChem CID 10243646) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane |
| PubChem CID | 10243646 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane |
| SMILES | C=C(c1ccccc1)C1COC2(CCCC2)OO1 |
| InChI | InChI=1S/C15H18O3/c1-12(13-7-3-2-4-8-13)14-11-16-15(18-17-14)9-5-6-10-15/h2-4,7-8,14H,1,5-6,9-11H2 |
| InChIKey | IOZWAIJLDQZLLK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane?
The IUPAC name of 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane (CID 10243646) is 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane.
What is the SMILES notation for 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane?
The canonical SMILES for 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane is C=C(c1ccccc1)C1COC2(CCCC2)OO1.
What is the InChIKey of 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane?
The InChIKey is IOZWAIJLDQZLLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c1-12(13-7-3-2-4-8-13)14-11-16-15(18-17-14)9-5-6-10-15/h2-4,7-8,14H,1,5-6,9-11H2.
What are the key properties of 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane?
8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane has a molecular weight of 246.31 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1-phenylethenyl)-6,7,10-trioxaspiro[4.5]decane is sourced from PubChem (CID 10243646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).