C21H25N3O4 — CID 102436701
(2E)-N-[(5R,6R,7R,8S)-6,7-dihydroxy-5-(hydroxymethyl)-2-(2-phenylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]penta-2,4-dienamide (PubChem CID 102436701) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2E)-N-[(5R,6R,7R,8S)-6,7-dihydroxy-5-(hydroxymethyl)-2-(2-phenylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]penta-2,4-dienamide.
| Compound Name | (2E)-N-[(5R,6R,7R,8S)-6,7-dihydroxy-5-(hydroxymethyl)-2-(2-phenylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 102436701 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2E)-N-[(5R,6R,7R,8S)-6,7-dihydroxy-5-(hydroxymethyl)-2-(2-phenylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]penta-2,4-dienamide |
| SMILES | C=C/C=C/C(=O)N[C@H]1c2nc(CCc3ccccc3)cn2[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H25N3O4/c1-2-3-9-17(26)23-18-20(28)19(27)16(13-25)24-12-15(22-21(18)24)11-10-14-7-5-4-6-8-14/h2-9,12,16,18-20,25,27-28H,1,10-11,13H2,(H,23,26)/b9-3+/t16-,18-,19-,20-/m1/s1 |
| InChIKey | LVKBBSPEBHHPCN-RRRUERACSA-N |
| XLogP | 0.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|