About methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate
methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate (PubChem CID 102436911) has the molecular formula C12H26O3Si2
and a molecular weight of 274.51 g/mol. Its IUPAC name is methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate.
Molecular Properties
| Compound Name | methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate |
| PubChem CID | 102436911 |
| Molecular Formula | C12H26O3Si2 |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate |
| SMILES | COC(=O)OC/C(=C\[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C12H26O3Si2/c1-14-12(13)15-8-11(9-16(2,3)4)10-17(5,6)7/h9H,8,10H2,1-7H3/b11-9+ |
| InChIKey | ZAZBURCIJPPFKD-PKNBQFBNSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate?
The IUPAC name of methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate (CID 102436911) is methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate.
What is the SMILES notation for methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate?
The canonical SMILES for methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate is COC(=O)OC/C(=C\[Si](C)(C)C)C[Si](C)(C)C.
What is the InChIKey of methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate?
The InChIKey is ZAZBURCIJPPFKD-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H26O3Si2/c1-14-12(13)15-8-11(9-16(2,3)4)10-17(5,6)7/h9H,8,10H2,1-7H3/b11-9+.
What are the key properties of methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate?
methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate has a molecular weight of 274.51 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [(E)-3-trimethylsilyl-2-(trimethylsilylmethyl)prop-2-enyl] carbonate is sourced from PubChem (CID 102436911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).