About CID 102437163
CID 102437163 (PubChem CID 102437163) has the molecular formula C9H10NO
and a molecular weight of 148.19 g/mol.
Molecular Properties
| Compound Name | CID 102437163 |
| PubChem CID | 102437163 |
| Molecular Formula | C9H10NO |
| Molecular Weight | 148.19 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | — |
| SMILES | CN1c2ccccc2[CH]C1O |
| InChI | InChI=1S/C9H10NO/c1-10-8-5-3-2-4-7(8)6-9(10)11/h2-6,9,11H,1H3 |
| InChIKey | IPNBHWDTLMURGW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 102437163 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102437163?
The IUPAC name of CID 102437163 (CID 102437163) is not available.
What is the SMILES notation for CID 102437163?
The canonical SMILES for CID 102437163 is CN1c2ccccc2[CH]C1O.
What is the InChIKey of CID 102437163?
The InChIKey is IPNBHWDTLMURGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10NO/c1-10-8-5-3-2-4-7(8)6-9(10)11/h2-6,9,11H,1H3.
What are the key properties of CID 102437163?
CID 102437163 has a molecular weight of 148.19 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102437163 is sourced from PubChem (CID 102437163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).