C11H17NO5 — CID 102437477
dimethyl (2R,3R,3aR)-2-methyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate (PubChem CID 102437477) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is dimethyl (2R,3R,3aR)-2-methyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3R,3aR)-2-methyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102437477 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | dimethyl (2R,3R,3aR)-2-methyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2CCCN2O[C@@]1(C)C(=O)OC |
| InChI | InChI=1S/C11H17NO5/c1-11(10(14)16-3)8(9(13)15-2)7-5-4-6-12(7)17-11/h7-8H,4-6H2,1-3H3/t7-,8+,11-/m1/s1 |
| InChIKey | LYIPCOPOSUCWOT-VHSKPIJISA-N |
| XLogP | 0.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |