C13H18N2O — CID 102437518
3-[2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethyl]phenol (PubChem CID 102437518) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-[2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethyl]phenol.
| Compound Name | 3-[2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 102437518 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-[2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethyl]phenol |
| SMILES | CN1CCCN=C1CCc1cccc(O)c1 |
| InChI | InChI=1S/C13H18N2O/c1-15-9-3-8-14-13(15)7-6-11-4-2-5-12(16)10-11/h2,4-5,10,16H,3,6-9H2,1H3 |
| InChIKey | ZSUGXXVEDIYGTH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |