C6H7F3O — CID 102437968
2-(3,3-dideuterioprop-2-enoxy)-3,3,3-trifluoroprop-1-ene (PubChem CID 102437968) has the molecular formula C6H7F3O and a molecular weight of 154.13 g/mol. Its IUPAC name is 2-(3,3-dideuterioprop-2-enoxy)-3,3,3-trifluoroprop-1-ene.
| Compound Name | 2-(3,3-dideuterioprop-2-enoxy)-3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 102437968 |
| Molecular Formula | C6H7F3O |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-(3,3-dideuterioprop-2-enoxy)-3,3,3-trifluoroprop-1-ene |
| SMILES | [2H]C([2H])=CCOC(=C)C(F)(F)F |
| InChI | InChI=1S/C6H7F3O/c1-3-4-10-5(2)6(7,8)9/h3H,1-2,4H2/i1D2 |
| InChIKey | XPRNZUKKKWIHBQ-DICFDUPASA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|