C31H25N6NaO4S2 — CID 102438186
sodium 2-[4-[(4E)-4-[[4-[bis(2-cyanoethyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate (PubChem CID 102438186) has the molecular formula C31H25N6NaO4S2 and a molecular weight of 632.70 g/mol. Its IUPAC name is sodium 2-[4-[(4E)-4-[[4-[bis(2-cyanoethyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate.
| Compound Name | sodium 2-[4-[(4E)-4-[[4-[bis(2-cyanoethyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate |
|---|---|
| PubChem CID | 102438186 |
| Molecular Formula | C31H25N6NaO4S2 |
| Molecular Weight | 632.70 g/mol |
| Exact Mass | 632.13 |
| IUPAC Name | sodium 2-[4-[(4E)-4-[[4-[bis(2-cyanoethyl)amino]phenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]phenyl]-6-methyl-1,3-benzothiazole-7-sulfonate |
| SMILES | CC1=NN(c2ccc(-c3nc4ccc(C)c(S(=O)(=O)[O-])c4s3)cc2)C(=O)/C1=C/c1ccc(N(CCC#N)CCC#N)cc1.[Na+] |
| InChI | InChI=1S/C31H26N6O4S2.Na/c1-20-5-14-27-28(29(20)43(39,40)41)42-30(34-27)23-8-12-25(13-9-23)37-31(38)26(21(2)35-37)19-22-6-10-24(11-7-22)36(17-3-15-32)18-4-16-33;/h5-14,19H,3-4,17-18H2,1-2H3,(H,39,40,41);/q;+1/p-1/b26-19+; |
| InChIKey | VHUULLZYYUPXHC-MGXPCBRFSA-M |
| XLogP | 2.62 |
| TPSA | 153.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.70 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|