C19H5Cl4F11KNO6S — CID 102438315
potassium 2-carboxy-3,4,5,6-tetrachloro-N-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyloxy)phenyl]benzenecarboximidate (PubChem CID 102438315) has the molecular formula C19H5Cl4F11KNO6S and a molecular weight of 765.20 g/mol. Its IUPAC name is potassium 2-carboxy-3,4,5,6-tetrachloro-N-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyloxy)phenyl]benzenecarboximidate.
| Compound Name | potassium 2-carboxy-3,4,5,6-tetrachloro-N-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyloxy)phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 102438315 |
| Molecular Formula | C19H5Cl4F11KNO6S |
| Molecular Weight | 765.20 g/mol |
| Exact Mass | 762.81 |
| IUPAC Name | potassium 2-carboxy-3,4,5,6-tetrachloro-N-[3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentylsulfonyloxy)phenyl]benzenecarboximidate |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1/C([O-])=N/c1cccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1.[K+] |
| InChI | InChI=1S/C19H6Cl4F11NO6S.K/c20-9-7(8(14(37)38)10(21)12(23)11(9)22)13(36)35-5-2-1-3-6(4-5)41-42(39,40)19(33,34)17(28,29)15(24,25)16(26,27)18(30,31)32;/h1-4H,(H,35,36)(H,37,38);/q;+1/p-1 |
| InChIKey | VZVBVGFCRFYOSX-UHFFFAOYSA-M |
| XLogP | 4.21 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|