About methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate
methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate (PubChem CID 102439204) has the molecular formula C14H24N2O4
and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate |
| PubChem CID | 102439204 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@H](NC(=O)[C@]1(N)CCC=C[C@H]1CO)C(C)C |
| InChI | InChI=1S/C14H24N2O4/c1-9(2)11(12(18)20-3)16-13(19)14(15)7-5-4-6-10(14)8-17/h4,6,9-11,17H,5,7-8,15H2,1-3H3,(H,16,19)/t10-,11+,14-/m0/s1 |
| InChIKey | IFFMMPRSXLCGLB-WDMOLILDSA-N |
| XLogP | -0.04 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate?
The IUPAC name of methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate (CID 102439204) is methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate.
What is the SMILES notation for methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate?
The canonical SMILES for methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate is COC(=O)[C@H](NC(=O)[C@]1(N)CCC=C[C@H]1CO)C(C)C.
What is the InChIKey of methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate?
The InChIKey is IFFMMPRSXLCGLB-WDMOLILDSA-N. The full InChI is InChI=1S/C14H24N2O4/c1-9(2)11(12(18)20-3)16-13(19)14(15)7-5-4-6-10(14)8-17/h4,6,9-11,17H,5,7-8,15H2,1-3H3,(H,16,19)/t10-,11+,14-/m0/s1.
What are the key properties of methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate?
methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate has a molecular weight of 284.36 g/mol, XLogP of -0.04, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[[(1S,2R)-1-amino-2-(hydroxymethyl)cyclohex-3-ene-1-carbonyl]amino]-3-methylbutanoate is sourced from PubChem (CID 102439204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).