C40H58N6O4 — CID 102439261
methyl 3,5-bis[3-[[3,5-bis(3-aminopropyl)benzoyl]amino]propyl]benzoate (PubChem CID 102439261) has the molecular formula C40H58N6O4 and a molecular weight of 686.94 g/mol. Its IUPAC name is methyl 3,5-bis[3-[[3,5-bis(3-aminopropyl)benzoyl]amino]propyl]benzoate.
| Compound Name | methyl 3,5-bis[3-[[3,5-bis(3-aminopropyl)benzoyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 102439261 |
| Molecular Formula | C40H58N6O4 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.45 |
| IUPAC Name | methyl 3,5-bis[3-[[3,5-bis(3-aminopropyl)benzoyl]amino]propyl]benzoate |
| SMILES | COC(=O)c1cc(CCCNC(=O)c2cc(CCCN)cc(CCCN)c2)cc(CCCNC(=O)c2cc(CCCN)cc(CCCN)c2)c1 |
| InChI | InChI=1S/C40H58N6O4/c1-50-40(49)37-27-33(12-6-18-45-38(47)35-23-29(8-2-14-41)20-30(24-35)9-3-15-42)22-34(28-37)13-7-19-46-39(48)36-25-31(10-4-16-43)21-32(26-36)11-5-17-44/h20-28H,2-19,41-44H2,1H3,(H,45,47)(H,46,48) |
| InChIKey | JMXKPUAOCSFGMD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 188.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|