C16H28O2 — CID 10243947
(1S,2S,6R,8S,9S,10R)-2,6,8,9-tetramethyltricyclo[6.3.1.02,6]dodecane-9,10-diol (PubChem CID 10243947) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1S,2S,6R,8S,9S,10R)-2,6,8,9-tetramethyltricyclo[6.3.1.02,6]dodecane-9,10-diol.
| Compound Name | (1S,2S,6R,8S,9S,10R)-2,6,8,9-tetramethyltricyclo[6.3.1.02,6]dodecane-9,10-diol |
|---|---|
| PubChem CID | 10243947 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1S,2S,6R,8S,9S,10R)-2,6,8,9-tetramethyltricyclo[6.3.1.02,6]dodecane-9,10-diol |
| SMILES | C[C@]12CCC[C@@]1(C)[C@@H]1C[C@@H](O)[C@@](C)(O)[C@@](C)(C1)C2 |
| InChI | InChI=1S/C16H28O2/c1-13-6-5-7-15(13,3)11-8-12(17)16(4,18)14(2,9-11)10-13/h11-12,17-18H,5-10H2,1-4H3/t11-,12-,13-,14+,15+,16-/m1/s1 |
| InChIKey | XRQSTTNKGOSZDE-FGZZBPHYSA-N |
| XLogP | 3.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |