About methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate
methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate (PubChem CID 102439919) has the molecular formula C11H14O6
and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate |
| PubChem CID | 102439919 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate |
| SMILES | COC(=O)CCC1(OO)C=CC(=O)C(OC)=C1 |
| InChI | InChI=1S/C11H14O6/c1-15-9-7-11(17-14,5-3-8(9)12)6-4-10(13)16-2/h3,5,7,14H,4,6H2,1-2H3 |
| InChIKey | VCERMVRQLGEIEI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
The IUPAC name of methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate (CID 102439919) is methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate.
What is the SMILES notation for methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
The canonical SMILES for methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate is COC(=O)CCC1(OO)C=CC(=O)C(OC)=C1.
What is the InChIKey of methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
The InChIKey is VCERMVRQLGEIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O6/c1-15-9-7-11(17-14,5-3-8(9)12)6-4-10(13)16-2/h3,5,7,14H,4,6H2,1-2H3.
What are the key properties of methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate?
methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate has a molecular weight of 242.23 g/mol, XLogP of 0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1-hydroperoxy-3-methoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoate is sourced from PubChem (CID 102439919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).