C19H34O2Si — CID 102439939
(3aR,5S,6R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-7a-methyl-4,5,6,7-tetrahydro-3H-inden-3a-ol (PubChem CID 102439939) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (3aR,5S,6R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-7a-methyl-4,5,6,7-tetrahydro-3H-inden-3a-ol.
| Compound Name | (3aR,5S,6R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-7a-methyl-4,5,6,7-tetrahydro-3H-inden-3a-ol |
|---|---|
| PubChem CID | 102439939 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (3aR,5S,6R,7aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-ethenyl-7a-methyl-4,5,6,7-tetrahydro-3H-inden-3a-ol |
| SMILES | C=C[C@@H]1C[C@]2(O)CC=C[C@]2(C)C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O2Si/c1-8-15-13-19(20)11-9-10-18(19,5)12-16(15)14-21-22(6,7)17(2,3)4/h8-10,15-16,20H,1,11-14H2,2-7H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | MTVOYFNKHVHQKD-UKBAYJJMSA-N |
| XLogP | 4.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|