About propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate
propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate (PubChem CID 102440229) has the molecular formula C11H16O4
and a molecular weight of 212.25 g/mol. Its IUPAC name is propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate |
| PubChem CID | 102440229 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate |
| SMILES | CC1=CO[C@@](C)(C(=O)OC(C)C)CC1=O |
| InChI | InChI=1S/C11H16O4/c1-7(2)15-10(13)11(4)5-9(12)8(3)6-14-11/h6-7H,5H2,1-4H3/t11-/m1/s1 |
| InChIKey | XIVINSFRMSIJHO-LLVKDONJSA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate?
The IUPAC name of propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate (CID 102440229) is propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate.
What is the SMILES notation for propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate?
The canonical SMILES for propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate is CC1=CO[C@@](C)(C(=O)OC(C)C)CC1=O.
What is the InChIKey of propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate?
The InChIKey is XIVINSFRMSIJHO-LLVKDONJSA-N. The full InChI is InChI=1S/C11H16O4/c1-7(2)15-10(13)11(4)5-9(12)8(3)6-14-11/h6-7H,5H2,1-4H3/t11-/m1/s1.
What are the key properties of propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate?
propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate has a molecular weight of 212.25 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2R)-2,5-dimethyl-4-oxo-3H-pyran-2-carboxylate is sourced from PubChem (CID 102440229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).