About N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide
N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide (PubChem CID 10244077) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide |
| PubChem CID | 10244077 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)-c1cc(=O)[nH]nc1CC2 |
| InChI | InChI=1S/C14H13N3O2/c1-8(18)15-10-4-2-9-3-5-13-12(11(9)6-10)7-14(19)17-16-13/h2,4,6-7H,3,5H2,1H3,(H,15,18)(H,17,19) |
| InChIKey | DUKKCHCFGYNQEG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide?
The IUPAC name of N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide (CID 10244077) is N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide.
What is the SMILES notation for N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide?
The canonical SMILES for N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide is CC(=O)Nc1ccc2c(c1)-c1cc(=O)[nH]nc1CC2.
What is the InChIKey of N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide?
The InChIKey is DUKKCHCFGYNQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c1-8(18)15-10-4-2-9-3-5-13-12(11(9)6-10)7-14(19)17-16-13/h2,4,6-7H,3,5H2,1H3,(H,15,18)(H,17,19).
What are the key properties of N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide?
N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide has a molecular weight of 255.28 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-5,6-dihydro-3H-benzo[f]cinnolin-9-yl)acetamide is sourced from PubChem (CID 10244077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).