About 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol
6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol (PubChem CID 102441033) has the molecular formula C18H20N4O
and a molecular weight of 308.39 g/mol. Its IUPAC name is 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol.
Molecular Properties
| Compound Name | 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol |
| PubChem CID | 102441033 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol |
| SMILES | Cc1ccc(C2=NNC(NN)=CC2(O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20N4O/c1-12-3-7-14(8-4-12)17-18(23,11-16(20-19)21-22-17)15-9-5-13(2)6-10-15/h3-11,20-21,23H,19H2,1-2H3 |
| InChIKey | RLLDJFDNRFALMD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol?
The IUPAC name of 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol (CID 102441033) is 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol.
What is the SMILES notation for 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol?
The canonical SMILES for 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol is Cc1ccc(C2=NNC(NN)=CC2(O)c2ccc(C)cc2)cc1.
What is the InChIKey of 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol?
The InChIKey is RLLDJFDNRFALMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O/c1-12-3-7-14(8-4-12)17-18(23,11-16(20-19)21-22-17)15-9-5-13(2)6-10-15/h3-11,20-21,23H,19H2,1-2H3.
What are the key properties of 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol?
6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol has a molecular weight of 308.39 g/mol, XLogP of 1.80, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinyl-3,4-bis(4-methylphenyl)-1H-pyridazin-4-ol is sourced from PubChem (CID 102441033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).