C5H8F5NO2S — CID 102441606
N-ethyl-1,1,2,2,2-pentafluoro-N-methylethanesulfonamide (PubChem CID 102441606) has the molecular formula C5H8F5NO2S and a molecular weight of 241.18 g/mol. Its IUPAC name is N-ethyl-1,1,2,2,2-pentafluoro-N-methylethanesulfonamide.
| Compound Name | N-ethyl-1,1,2,2,2-pentafluoro-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102441606 |
| Molecular Formula | C5H8F5NO2S |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | N-ethyl-1,1,2,2,2-pentafluoro-N-methylethanesulfonamide |
| SMILES | CCN(C)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H8F5NO2S/c1-3-11(2)14(12,13)5(9,10)4(6,7)8/h3H2,1-2H3 |
| InChIKey | XZPSPGRKCGJACB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|