About (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate
(Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate (PubChem CID 102441783) has the molecular formula C17H17BrNO-
and a molecular weight of 331.23 g/mol. Its IUPAC name is (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate.
Molecular Properties
| Compound Name | (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate |
| PubChem CID | 102441783 |
| Molecular Formula | C17H17BrNO- |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate |
| SMILES | Cc1cc(C)c(N(C)/C([O-])=C/c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C17H18BrNO/c1-12-9-13(2)17(15(18)10-12)19(3)16(20)11-14-7-5-4-6-8-14/h4-11,20H,1-3H3/p-1/b16-11- |
| InChIKey | ZHIXSXAJSXEDLD-WJDWOHSUSA-M |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate?
The IUPAC name of (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate (CID 102441783) is (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate.
What is the SMILES notation for (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate?
The canonical SMILES for (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate is Cc1cc(C)c(N(C)/C([O-])=C/c2ccccc2)c(Br)c1.
What is the InChIKey of (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate?
The InChIKey is ZHIXSXAJSXEDLD-WJDWOHSUSA-M. The full InChI is InChI=1S/C17H18BrNO/c1-12-9-13(2)17(15(18)10-12)19(3)16(20)11-14-7-5-4-6-8-14/h4-11,20H,1-3H3/p-1/b16-11-.
What are the key properties of (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate?
(Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate has a molecular weight of 331.23 g/mol, XLogP of 3.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(2-bromo-N,4,6-trimethylanilino)-2-phenylethenolate is sourced from PubChem (CID 102441783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).