About 4-octylthieno[3,2-b]pyrrole-5,6-dione
4-octylthieno[3,2-b]pyrrole-5,6-dione (PubChem CID 102441986) has the molecular formula C14H19NO2S
and a molecular weight of 265.38 g/mol. Its IUPAC name is 4-octylthieno[3,2-b]pyrrole-5,6-dione.
Molecular Properties
| Compound Name | 4-octylthieno[3,2-b]pyrrole-5,6-dione |
| PubChem CID | 102441986 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-octylthieno[3,2-b]pyrrole-5,6-dione |
| SMILES | CCCCCCCCN1C(=O)C(=O)c2sccc21 |
| InChI | InChI=1S/C14H19NO2S/c1-2-3-4-5-6-7-9-15-11-8-10-18-13(11)12(16)14(15)17/h8,10H,2-7,9H2,1H3 |
| InChIKey | KIHSEKCYRDIXLV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-octylthieno[3,2-b]pyrrole-5,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-octylthieno[3,2-b]pyrrole-5,6-dione?
The IUPAC name of 4-octylthieno[3,2-b]pyrrole-5,6-dione (CID 102441986) is 4-octylthieno[3,2-b]pyrrole-5,6-dione.
What is the SMILES notation for 4-octylthieno[3,2-b]pyrrole-5,6-dione?
The canonical SMILES for 4-octylthieno[3,2-b]pyrrole-5,6-dione is CCCCCCCCN1C(=O)C(=O)c2sccc21.
What is the InChIKey of 4-octylthieno[3,2-b]pyrrole-5,6-dione?
The InChIKey is KIHSEKCYRDIXLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2S/c1-2-3-4-5-6-7-9-15-11-8-10-18-13(11)12(16)14(15)17/h8,10H,2-7,9H2,1H3.
What are the key properties of 4-octylthieno[3,2-b]pyrrole-5,6-dione?
4-octylthieno[3,2-b]pyrrole-5,6-dione has a molecular weight of 265.38 g/mol, XLogP of 3.64, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-octylthieno[3,2-b]pyrrole-5,6-dione is sourced from PubChem (CID 102441986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).