About 2-phenylindeno[2,1-d]pyrimidin-9-one
2-phenylindeno[2,1-d]pyrimidin-9-one (PubChem CID 10244232) has the molecular formula C17H10N2O
and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-phenylindeno[2,1-d]pyrimidin-9-one.
Molecular Properties
| Compound Name | 2-phenylindeno[2,1-d]pyrimidin-9-one |
| PubChem CID | 10244232 |
| Molecular Formula | C17H10N2O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-phenylindeno[2,1-d]pyrimidin-9-one |
| SMILES | O=C1c2ccccc2-c2cnc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C17H10N2O/c20-16-13-9-5-4-8-12(13)14-10-18-17(19-15(14)16)11-6-2-1-3-7-11/h1-10H |
| InChIKey | ZPFBYRRSJUZGJP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylindeno[2,1-d]pyrimidin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylindeno[2,1-d]pyrimidin-9-one?
The IUPAC name of 2-phenylindeno[2,1-d]pyrimidin-9-one (CID 10244232) is 2-phenylindeno[2,1-d]pyrimidin-9-one.
What is the SMILES notation for 2-phenylindeno[2,1-d]pyrimidin-9-one?
The canonical SMILES for 2-phenylindeno[2,1-d]pyrimidin-9-one is O=C1c2ccccc2-c2cnc(-c3ccccc3)nc21.
What is the InChIKey of 2-phenylindeno[2,1-d]pyrimidin-9-one?
The InChIKey is ZPFBYRRSJUZGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10N2O/c20-16-13-9-5-4-8-12(13)14-10-18-17(19-15(14)16)11-6-2-1-3-7-11/h1-10H.
What are the key properties of 2-phenylindeno[2,1-d]pyrimidin-9-one?
2-phenylindeno[2,1-d]pyrimidin-9-one has a molecular weight of 258.28 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylindeno[2,1-d]pyrimidin-9-one is sourced from PubChem (CID 10244232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).