C21H32O4 — CID 102442820
(6E,10R,11R,14E,15aS)-11-hydroxy-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-2-one (PubChem CID 102442820) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (6E,10R,11R,14E,15aS)-11-hydroxy-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-2-one.
| Compound Name | (6E,10R,11R,14E,15aS)-11-hydroxy-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-2-one |
|---|---|
| PubChem CID | 102442820 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (6E,10R,11R,14E,15aS)-11-hydroxy-10-methoxy-3,6,10,14-tetramethyl-4,5,8,9,11,12,13,15a-octahydrocyclotetradeca[b]furan-2-one |
| SMILES | CO[C@]1(C)CC/C=C(\C)CCC2=C(C)C(=O)O[C@H]2/C=C(\C)CC[C@H]1O |
| InChI | InChI=1S/C21H32O4/c1-14-7-6-12-21(4,24-5)19(22)11-9-15(2)13-18-17(10-8-14)16(3)20(23)25-18/h7,13,18-19,22H,6,8-12H2,1-5H3/b14-7+,15-13+/t18-,19+,21+/m0/s1 |
| InChIKey | OGDIPDDKOOVFTL-LFDXQZSNSA-N |
| XLogP | 4.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|