About 10-methyl-5,5-dioxophenothiazin-3-amine
10-methyl-5,5-dioxophenothiazin-3-amine (PubChem CID 10244354) has the molecular formula C13H12N2O2S
and a molecular weight of 260.32 g/mol. Its IUPAC name is 10-methyl-5,5-dioxophenothiazin-3-amine.
Molecular Properties
| Compound Name | 10-methyl-5,5-dioxophenothiazin-3-amine |
| PubChem CID | 10244354 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 10-methyl-5,5-dioxophenothiazin-3-amine |
| SMILES | CN1c2ccccc2S(=O)(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C13H12N2O2S/c1-15-10-4-2-3-5-12(10)18(16,17)13-8-9(14)6-7-11(13)15/h2-8H,14H2,1H3 |
| InChIKey | HBRIMBXSHWNMQV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 10-methyl-5,5-dioxophenothiazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-5,5-dioxophenothiazin-3-amine?
The IUPAC name of 10-methyl-5,5-dioxophenothiazin-3-amine (CID 10244354) is 10-methyl-5,5-dioxophenothiazin-3-amine.
What is the SMILES notation for 10-methyl-5,5-dioxophenothiazin-3-amine?
The canonical SMILES for 10-methyl-5,5-dioxophenothiazin-3-amine is CN1c2ccccc2S(=O)(=O)c2cc(N)ccc21.
What is the InChIKey of 10-methyl-5,5-dioxophenothiazin-3-amine?
The InChIKey is HBRIMBXSHWNMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2S/c1-15-10-4-2-3-5-12(10)18(16,17)13-8-9(14)6-7-11(13)15/h2-8H,14H2,1H3.
What are the key properties of 10-methyl-5,5-dioxophenothiazin-3-amine?
10-methyl-5,5-dioxophenothiazin-3-amine has a molecular weight of 260.32 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-5,5-dioxophenothiazin-3-amine is sourced from PubChem (CID 10244354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).