C9H12O4 — CID 102443624
methyl (2S,3S)-2,3-bis(ethenyl)-3-methoxyoxirane-2-carboxylate (PubChem CID 102443624) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl (2S,3S)-2,3-bis(ethenyl)-3-methoxyoxirane-2-carboxylate.
| Compound Name | methyl (2S,3S)-2,3-bis(ethenyl)-3-methoxyoxirane-2-carboxylate |
|---|---|
| PubChem CID | 102443624 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | methyl (2S,3S)-2,3-bis(ethenyl)-3-methoxyoxirane-2-carboxylate |
| SMILES | C=C[C@]1(OC)O[C@]1(C=C)C(=O)OC |
| InChI | InChI=1S/C9H12O4/c1-5-8(7(10)11-3)9(6-2,12-4)13-8/h5-6H,1-2H2,3-4H3/t8-,9+/m1/s1 |
| InChIKey | IISCTXGWHWWHIK-BDAKNGLRSA-N |
| XLogP | 0.64 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|