About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline (PubChem CID 10244367) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline |
| PubChem CID | 10244367 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline |
| SMILES | CC/C(=N\OC)c1ccccc1NCC1=NCCN1 |
| InChI | InChI=1S/C14H20N4O/c1-3-12(18-19-2)11-6-4-5-7-13(11)17-10-14-15-8-9-16-14/h4-7,17H,3,8-10H2,1-2H3,(H,15,16)/b18-12+ |
| InChIKey | VNALJYKFTZMOJJ-LDADJPATSA-N |
| XLogP | 1.86 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline (CID 10244367) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline is CC/C(=N\OC)c1ccccc1NCC1=NCCN1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline?
The InChIKey is VNALJYKFTZMOJJ-LDADJPATSA-N. The full InChI is InChI=1S/C14H20N4O/c1-3-12(18-19-2)11-6-4-5-7-13(11)17-10-14-15-8-9-16-14/h4-7,17H,3,8-10H2,1-2H3,(H,15,16)/b18-12+.
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline has a molecular weight of 260.34 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-[(E)-C-ethyl-N-methoxycarbonimidoyl]aniline is sourced from PubChem (CID 10244367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).