C23H45NO4Si — CID 102443693
(4S)-3-[(2S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 102443693) has the molecular formula C23H45NO4Si and a molecular weight of 427.70 g/mol. Its IUPAC name is (4S)-3-[(2S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102443693 |
| Molecular Formula | C23H45NO4Si |
| Molecular Weight | 427.70 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (4S)-3-[(2S,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyloctanoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@H](C)C(=O)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C23H45NO4Si/c1-12-16(4)20(28-29(10,11)23(7,8)9)17(5)13-18(6)21(25)24-19(15(2)3)14-27-22(24)26/h15-20H,12-14H2,1-11H3/t16-,17-,18-,19+,20+/m0/s1 |
| InChIKey | YAYPUQLTAXCPOM-WKWVNEEDSA-N |
| XLogP | 6.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|