About 2-naphthalen-1-yl-1,3-benzoxazol-6-ol
2-naphthalen-1-yl-1,3-benzoxazol-6-ol (PubChem CID 10244394) has the molecular formula C17H11NO2
and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-naphthalen-1-yl-1,3-benzoxazol-6-ol.
Molecular Properties
| Compound Name | 2-naphthalen-1-yl-1,3-benzoxazol-6-ol |
| PubChem CID | 10244394 |
| Molecular Formula | C17H11NO2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-naphthalen-1-yl-1,3-benzoxazol-6-ol |
| SMILES | Oc1ccc2nc(-c3cccc4ccccc34)oc2c1 |
| InChI | InChI=1S/C17H11NO2/c19-12-8-9-15-16(10-12)20-17(18-15)14-7-3-5-11-4-1-2-6-13(11)14/h1-10,19H |
| InChIKey | LYJKLNQQSXCGDI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-naphthalen-1-yl-1,3-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-yl-1,3-benzoxazol-6-ol?
The IUPAC name of 2-naphthalen-1-yl-1,3-benzoxazol-6-ol (CID 10244394) is 2-naphthalen-1-yl-1,3-benzoxazol-6-ol.
What is the SMILES notation for 2-naphthalen-1-yl-1,3-benzoxazol-6-ol?
The canonical SMILES for 2-naphthalen-1-yl-1,3-benzoxazol-6-ol is Oc1ccc2nc(-c3cccc4ccccc34)oc2c1.
What is the InChIKey of 2-naphthalen-1-yl-1,3-benzoxazol-6-ol?
The InChIKey is LYJKLNQQSXCGDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO2/c19-12-8-9-15-16(10-12)20-17(18-15)14-7-3-5-11-4-1-2-6-13(11)14/h1-10,19H.
What are the key properties of 2-naphthalen-1-yl-1,3-benzoxazol-6-ol?
2-naphthalen-1-yl-1,3-benzoxazol-6-ol has a molecular weight of 261.28 g/mol, XLogP of 4.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-yl-1,3-benzoxazol-6-ol is sourced from PubChem (CID 10244394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).