About N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine
N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine (PubChem CID 102443994) has the molecular formula C9H20F3NSi
and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine.
Molecular Properties
| Compound Name | N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine |
| PubChem CID | 102443994 |
| Molecular Formula | C9H20F3NSi |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine |
| SMILES | CCN(CC)[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C9H20F3NSi/c1-5-13(6-2)14(3,4)8-7-9(10,11)12/h5-8H2,1-4H3 |
| InChIKey | IOIWJPGYXIAPEP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine?
The IUPAC name of N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine (CID 102443994) is N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine.
What is the SMILES notation for N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine?
The canonical SMILES for N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine is CCN(CC)[Si](C)(C)CCC(F)(F)F.
What is the InChIKey of N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine?
The InChIKey is IOIWJPGYXIAPEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20F3NSi/c1-5-13(6-2)14(3,4)8-7-9(10,11)12/h5-8H2,1-4H3.
What are the key properties of N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine?
N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine has a molecular weight of 227.35 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethyl(3,3,3-trifluoropropyl)silyl]-N-ethylethanamine is sourced from PubChem (CID 102443994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).