C48H34F6 — CID 102444033
5,12-bis(3,5-dimethylphenyl)-6,11-bis[4-(trifluoromethyl)phenyl]tetracene (PubChem CID 102444033) has the molecular formula C48H34F6 and a molecular weight of 724.79 g/mol. Its IUPAC name is 5,12-bis(3,5-dimethylphenyl)-6,11-bis[4-(trifluoromethyl)phenyl]tetracene.
| Compound Name | 5,12-bis(3,5-dimethylphenyl)-6,11-bis[4-(trifluoromethyl)phenyl]tetracene |
|---|---|
| PubChem CID | 102444033 |
| Molecular Formula | C48H34F6 |
| Molecular Weight | 724.79 g/mol |
| Exact Mass | 724.26 |
| IUPAC Name | 5,12-bis(3,5-dimethylphenyl)-6,11-bis[4-(trifluoromethyl)phenyl]tetracene |
| SMILES | Cc1cc(C)cc(-c2c3ccccc3c(-c3cc(C)cc(C)c3)c3c(-c4ccc(C(F)(F)F)cc4)c4ccccc4c(-c4ccc(C(F)(F)F)cc4)c23)c1 |
| InChI | InChI=1S/C48H34F6/c1-27-21-28(2)24-33(23-27)43-39-11-7-8-12-40(39)44(34-25-29(3)22-30(4)26-34)46-42(32-15-19-36(20-16-32)48(52,53)54)38-10-6-5-9-37(38)41(45(43)46)31-13-17-35(18-14-31)47(49,50)51/h5-26H,1-4H3 |
| InChIKey | DVWQSDDNEWSLAI-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.79 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|