C19H16ClFN2O2 — CID 102444240
4-(4-chloro-2-fluorophenyl)-2-[4-(dimethoxymethyl)phenyl]pyrimidine (PubChem CID 102444240) has the molecular formula C19H16ClFN2O2 and a molecular weight of 358.80 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenyl)-2-[4-(dimethoxymethyl)phenyl]pyrimidine.
| Compound Name | 4-(4-chloro-2-fluorophenyl)-2-[4-(dimethoxymethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 102444240 |
| Molecular Formula | C19H16ClFN2O2 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-(4-chloro-2-fluorophenyl)-2-[4-(dimethoxymethyl)phenyl]pyrimidine |
| SMILES | COC(OC)c1ccc(-c2nccc(-c3ccc(Cl)cc3F)n2)cc1 |
| InChI | InChI=1S/C19H16ClFN2O2/c1-24-19(25-2)13-5-3-12(4-6-13)18-22-10-9-17(23-18)15-8-7-14(20)11-16(15)21/h3-11,19H,1-2H3 |
| InChIKey | RMGUXHIBBQCKIH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|