About 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine
3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine (PubChem CID 102444304) has the molecular formula C15H25NO7P2
and a molecular weight of 393.31 g/mol. Its IUPAC name is 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine.
Molecular Properties
| Compound Name | 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine |
| PubChem CID | 102444304 |
| Molecular Formula | C15H25NO7P2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine |
| SMILES | CCOP(=O)(OCC)C1(P(=O)(OCC)OCC)OC1c1cccnc1 |
| InChI | InChI=1S/C15H25NO7P2/c1-5-19-24(17,20-6-2)15(25(18,21-7-3)22-8-4)14(23-15)13-10-9-11-16-12-13/h9-12,14H,5-8H2,1-4H3 |
| InChIKey | YZDBTECUIVXRDD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine?
The IUPAC name of 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine (CID 102444304) is 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine.
What is the SMILES notation for 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine?
The canonical SMILES for 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine is CCOP(=O)(OCC)C1(P(=O)(OCC)OCC)OC1c1cccnc1.
What is the InChIKey of 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine?
The InChIKey is YZDBTECUIVXRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO7P2/c1-5-19-24(17,20-6-2)15(25(18,21-7-3)22-8-4)14(23-15)13-10-9-11-16-12-13/h9-12,14H,5-8H2,1-4H3.
What are the key properties of 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine?
3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine has a molecular weight of 393.31 g/mol, XLogP of 4.34, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-bis(diethoxyphosphoryl)oxiran-2-yl]pyridine is sourced from PubChem (CID 102444304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).