C32H42N3O+ — CID 102444316
2,4-ditert-butyl-6-[2-[3-(2,4,6-trimethylphenyl)benzimidazol-1-ium-1-yl]ethylamino]phenol (PubChem CID 102444316) has the molecular formula C32H42N3O+ and a molecular weight of 484.71 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[2-[3-(2,4,6-trimethylphenyl)benzimidazol-1-ium-1-yl]ethylamino]phenol.
| Compound Name | 2,4-ditert-butyl-6-[2-[3-(2,4,6-trimethylphenyl)benzimidazol-1-ium-1-yl]ethylamino]phenol |
|---|---|
| PubChem CID | 102444316 |
| Molecular Formula | C32H42N3O+ |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 2,4-ditert-butyl-6-[2-[3-(2,4,6-trimethylphenyl)benzimidazol-1-ium-1-yl]ethylamino]phenol |
| SMILES | Cc1cc(C)c(-n2c[n+](CCNc3cc(C(C)(C)C)cc(C(C)(C)C)c3O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C32H41N3O/c1-21-16-22(2)29(23(3)17-21)35-20-34(27-12-10-11-13-28(27)35)15-14-33-26-19-24(31(4,5)6)18-25(30(26)36)32(7,8)9/h10-13,16-20,33H,14-15H2,1-9H3/p+1 |
| InChIKey | VFBJSQRWFUNDHT-UHFFFAOYSA-O |
| XLogP | 7.26 |
| TPSA | 41.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|