About 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine
3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine (PubChem CID 102444660) has the molecular formula C17H15F3N2O2
and a molecular weight of 336.31 g/mol. Its IUPAC name is 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine.
Molecular Properties
| Compound Name | 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine |
| PubChem CID | 102444660 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine |
| SMILES | CCOCc1cnc2c(c(OC)nc3ccccc32)c1C(F)(F)F |
| InChI | InChI=1S/C17H15F3N2O2/c1-3-24-9-10-8-21-15-11-6-4-5-7-12(11)22-16(23-2)13(15)14(10)17(18,19)20/h4-8H,3,9H2,1-2H3 |
| InChIKey | VJZDRPZJSKFRPD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine?
The IUPAC name of 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine (CID 102444660) is 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine.
What is the SMILES notation for 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine?
The canonical SMILES for 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine is CCOCc1cnc2c(c(OC)nc3ccccc32)c1C(F)(F)F.
What is the InChIKey of 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine?
The InChIKey is VJZDRPZJSKFRPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N2O2/c1-3-24-9-10-8-21-15-11-6-4-5-7-12(11)22-16(23-2)13(15)14(10)17(18,19)20/h4-8H,3,9H2,1-2H3.
What are the key properties of 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine?
3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine has a molecular weight of 336.31 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethoxymethyl)-5-methoxy-4-(trifluoromethyl)benzo[h][1,6]naphthyridine is sourced from PubChem (CID 102444660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).