About disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate
disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate (PubChem CID 102445124) has the molecular formula C20H6Br2Cl2Na2O5
and a molecular weight of 602.96 g/mol. Its IUPAC name is disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate.
Molecular Properties
| Compound Name | disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate |
| PubChem CID | 102445124 |
| Molecular Formula | C20H6Br2Cl2Na2O5 |
| Molecular Weight | 602.96 g/mol |
| Exact Mass | 599.78 |
| IUPAC Name | disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate |
| SMILES | O=C([O-])c1c(Cl)ccc(Cl)c1-c1c2ccc(=O)c(Br)c-2oc2c(Br)c([O-])ccc12.[Na+].[Na+] |
| InChI | InChI=1S/C20H8Br2Cl2O5.2Na/c21-16-11(25)5-1-7-13(14-9(23)3-4-10(24)15(14)20(27)28)8-2-6-12(26)17(22)19(8)29-18(7)16;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2 |
| InChIKey | GYPXANNYCDCADH-UHFFFAOYSA-L |
| XLogP | -1.16 |
| TPSA | 93.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 602.96 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate?
The IUPAC name of disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate (CID 102445124) is disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate.
What is the SMILES notation for disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate?
The canonical SMILES for disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate is O=C([O-])c1c(Cl)ccc(Cl)c1-c1c2ccc(=O)c(Br)c-2oc2c(Br)c([O-])ccc12.[Na+].[Na+].
What is the InChIKey of disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate?
The InChIKey is GYPXANNYCDCADH-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H8Br2Cl2O5.2Na/c21-16-11(25)5-1-7-13(14-9(23)3-4-10(24)15(14)20(27)28)8-2-6-12(26)17(22)19(8)29-18(7)16;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2.
What are the key properties of disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate?
disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate has a molecular weight of 602.96 g/mol, XLogP of -1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3,6-dichloro-2-(4,5-dibromo-3-oxido-6-oxoxanthen-9-yl)benzoate is sourced from PubChem (CID 102445124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).