C20H32O — CID 102445552
(1S,3aS,6S,8aR)-3a,6-dimethyl-1-[(2E)-6-methylhepta-2,5-dien-2-yl]-1,2,3,4,6,7,8,8a-octahydroazulen-5-one (PubChem CID 102445552) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1S,3aS,6S,8aR)-3a,6-dimethyl-1-[(2E)-6-methylhepta-2,5-dien-2-yl]-1,2,3,4,6,7,8,8a-octahydroazulen-5-one.
| Compound Name | (1S,3aS,6S,8aR)-3a,6-dimethyl-1-[(2E)-6-methylhepta-2,5-dien-2-yl]-1,2,3,4,6,7,8,8a-octahydroazulen-5-one |
|---|---|
| PubChem CID | 102445552 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,3aS,6S,8aR)-3a,6-dimethyl-1-[(2E)-6-methylhepta-2,5-dien-2-yl]-1,2,3,4,6,7,8,8a-octahydroazulen-5-one |
| SMILES | CC(C)=CC/C=C(\C)[C@H]1CC[C@@]2(C)CC(=O)[C@@H](C)CC[C@H]12 |
| InChI | InChI=1S/C20H32O/c1-14(2)7-6-8-15(3)17-11-12-20(5)13-19(21)16(4)9-10-18(17)20/h7-8,16-18H,6,9-13H2,1-5H3/b15-8+/t16-,17+,18+,20-/m0/s1 |
| InChIKey | UGBNGEGMTBRTSC-BFLGVQHBSA-N |
| XLogP | 5.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|