C16H22O3 — CID 102445750
methyl (3S,3aS)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate (PubChem CID 102445750) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl (3S,3aS)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate.
| Compound Name | methyl (3S,3aS)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate |
|---|---|
| PubChem CID | 102445750 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl (3S,3aS)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-carboxylate |
| SMILES | C=C1CC(C(=O)OC)=C2CO[C@@H](C3CCCCC3)[C@@H]12 |
| InChI | InChI=1S/C16H22O3/c1-10-8-12(16(17)18-2)13-9-19-15(14(10)13)11-6-4-3-5-7-11/h11,14-15H,1,3-9H2,2H3/t14-,15-/m0/s1 |
| InChIKey | RGAKXCNYYHXJSA-GJZGRUSLSA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|