C15H16N4O7 — CID 102446020
10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-benzo[g]pteridine-2,4,8-trione (PubChem CID 102446020) has the molecular formula C15H16N4O7 and a molecular weight of 364.31 g/mol. Its IUPAC name is 10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-benzo[g]pteridine-2,4,8-trione.
| Compound Name | 10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-benzo[g]pteridine-2,4,8-trione |
|---|---|
| PubChem CID | 102446020 |
| Molecular Formula | C15H16N4O7 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 10-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-benzo[g]pteridine-2,4,8-trione |
| SMILES | O=c1ccc2nc3c(=O)[nH]c(=O)[nH]c3n(C[C@H](O)[C@H](O)[C@H](O)CO)c-2c1 |
| InChI | InChI=1S/C15H16N4O7/c20-5-10(23)12(24)9(22)4-19-8-3-6(21)1-2-7(8)16-11-13(19)17-15(26)18-14(11)25/h1-3,9-10,12,20,22-24H,4-5H2,(H2,17,18,25,26)/t9-,10+,12-/m0/s1 |
| InChIKey | GQSVRMZMYYVTRP-UMNHJUIQSA-N |
| XLogP | -3.05 |
| TPSA | 181.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|