C17H27NO4 — CID 102446030
methyl (1R,2R,3S,5S)-3-[(E)-hept-3-enoyl]oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 102446030) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is methyl (1R,2R,3S,5S)-3-[(E)-hept-3-enoyl]oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,5S)-3-[(E)-hept-3-enoyl]oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 102446030 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | methyl (1R,2R,3S,5S)-3-[(E)-hept-3-enoyl]oxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCC/C=C/CC(=O)O[C@H]1C[C@@H]2CC[C@H]([C@H]1C(=O)OC)N2C |
| InChI | InChI=1S/C17H27NO4/c1-4-5-6-7-8-15(19)22-14-11-12-9-10-13(18(12)2)16(14)17(20)21-3/h6-7,12-14,16H,4-5,8-11H2,1-3H3/b7-6+/t12-,13+,14-,16+/m0/s1 |
| InChIKey | ZKRRAUPNHLBXRD-DKHNYOHMSA-N |
| XLogP | 2.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|