C39H30F3N7OS — CID 102446199
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,2-trifluoro-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]acetamide (PubChem CID 102446199) has the molecular formula C39H30F3N7OS and a molecular weight of 701.78 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,2-trifluoro-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,2-trifluoro-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 102446199 |
| Molecular Formula | C39H30F3N7OS |
| Molecular Weight | 701.78 g/mol |
| Exact Mass | 701.22 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,2,2-trifluoro-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]acetamide |
| SMILES | CCc1nnc(N(Cc2ccc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C39H30F3N7OS/c1-2-34-43-45-37(51-34)48(36(50)39(40,41)42)26-27-22-24-28(25-23-27)32-20-12-13-21-33(32)35-44-46-47-49(35)38(29-14-6-3-7-15-29,30-16-8-4-9-17-30)31-18-10-5-11-19-31/h3-25H,2,26H2,1H3 |
| InChIKey | QNSCMLRKYRJISA-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 89.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.78 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|