C9H9F5IN — CID 102446342
(E)-2-iodo-3-(1,1,2,2,2-pentafluoroethyl)hept-2-enenitrile (PubChem CID 102446342) has the molecular formula C9H9F5IN and a molecular weight of 353.07 g/mol. Its IUPAC name is (E)-2-iodo-3-(1,1,2,2,2-pentafluoroethyl)hept-2-enenitrile.
| Compound Name | (E)-2-iodo-3-(1,1,2,2,2-pentafluoroethyl)hept-2-enenitrile |
|---|---|
| PubChem CID | 102446342 |
| Molecular Formula | C9H9F5IN |
| Molecular Weight | 353.07 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | (E)-2-iodo-3-(1,1,2,2,2-pentafluoroethyl)hept-2-enenitrile |
| SMILES | CCCC/C(=C(\I)C#N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F5IN/c1-2-3-4-6(7(15)5-16)8(10,11)9(12,13)14/h2-4H2,1H3/b7-6+ |
| InChIKey | PRZOXCIOBNXYHM-VOTSOKGWSA-N |
| XLogP | 4.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.07 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|