C10H9F7IN — CID 102446348
(E)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodohept-2-enenitrile (PubChem CID 102446348) has the molecular formula C10H9F7IN and a molecular weight of 403.08 g/mol. Its IUPAC name is (E)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodohept-2-enenitrile.
| Compound Name | (E)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodohept-2-enenitrile |
|---|---|
| PubChem CID | 102446348 |
| Molecular Formula | C10H9F7IN |
| Molecular Weight | 403.08 g/mol |
| Exact Mass | 402.97 |
| IUPAC Name | (E)-3-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodohept-2-enenitrile |
| SMILES | CCCC/C(=C(\I)C#N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H9F7IN/c1-2-3-4-6(7(18)5-19)8(11,12)9(13,14)10(15,16)17/h2-4H2,1H3/b7-6+ |
| InChIKey | ZHHWURMIEIBJJJ-VOTSOKGWSA-N |
| XLogP | 5.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.08 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|