C11H10F11N — CID 102446676
N,N-diethyl-3,3,4,4,5,5,6,6-octafluoro-2-(trifluoromethyl)cyclohexen-1-amine (PubChem CID 102446676) has the molecular formula C11H10F11N and a molecular weight of 365.19 g/mol. Its IUPAC name is N,N-diethyl-3,3,4,4,5,5,6,6-octafluoro-2-(trifluoromethyl)cyclohexen-1-amine.
| Compound Name | N,N-diethyl-3,3,4,4,5,5,6,6-octafluoro-2-(trifluoromethyl)cyclohexen-1-amine |
|---|---|
| PubChem CID | 102446676 |
| Molecular Formula | C11H10F11N |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N,N-diethyl-3,3,4,4,5,5,6,6-octafluoro-2-(trifluoromethyl)cyclohexen-1-amine |
| SMILES | CCN(CC)C1=C(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H10F11N/c1-3-23(4-2)6-5(9(16,17)18)7(12,13)10(19,20)11(21,22)8(6,14)15/h3-4H2,1-2H3 |
| InChIKey | HDQGPOUIJDWQHI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|