C21H36O2Si — CID 102446698
[(3S,3aR)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 102446698) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is [(3S,3aR)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,3aR)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102446698 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | [(3S,3aR)-3-cyclohexyl-4-methylidene-1,3,3a,5-tetrahydrocyclopenta[c]furan-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=C1CC(CO[Si](C)(C)C(C)(C)C)=C2CO[C@@H](C3CCCCC3)[C@H]12 |
| InChI | InChI=1S/C21H36O2Si/c1-15-12-17(13-23-24(5,6)21(2,3)4)18-14-22-20(19(15)18)16-10-8-7-9-11-16/h16,19-20H,1,7-14H2,2-6H3/t19-,20+/m1/s1 |
| InChIKey | MWVUWWOMXITCRG-UXHICEINSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|