About (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one
(3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one (PubChem CID 102446747) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one |
| PubChem CID | 102446747 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCN1C[C@@H](C)[C@H](CC(C)(C)C)C1=O |
| InChI | InChI=1S/C13H23NO/c1-6-7-14-9-10(2)11(12(14)15)8-13(3,4)5/h6,10-11H,1,7-9H2,2-5H3/t10-,11+/m1/s1 |
| InChIKey | QIPXWRPIEXXWRO-MNOVXSKESA-N |
| XLogP | 2.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one?
The IUPAC name of (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one (CID 102446747) is (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one.
What is the SMILES notation for (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one?
The canonical SMILES for (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one is C=CCN1C[C@@H](C)[C@H](CC(C)(C)C)C1=O.
What is the InChIKey of (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one?
The InChIKey is QIPXWRPIEXXWRO-MNOVXSKESA-N. The full InChI is InChI=1S/C13H23NO/c1-6-7-14-9-10(2)11(12(14)15)8-13(3,4)5/h6,10-11H,1,7-9H2,2-5H3/t10-,11+/m1/s1.
What are the key properties of (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one?
(3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one has a molecular weight of 209.33 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-(2,2-dimethylpropyl)-4-methyl-1-prop-2-enylpyrrolidin-2-one is sourced from PubChem (CID 102446747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).