C16H27NO — CID 102446759
(3R,4R)-4-but-3-enyl-3-(2,2-dimethylpropyl)-1-prop-2-enylpyrrolidin-2-one (PubChem CID 102446759) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (3R,4R)-4-but-3-enyl-3-(2,2-dimethylpropyl)-1-prop-2-enylpyrrolidin-2-one.
| Compound Name | (3R,4R)-4-but-3-enyl-3-(2,2-dimethylpropyl)-1-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102446759 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (3R,4R)-4-but-3-enyl-3-(2,2-dimethylpropyl)-1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCC[C@H]1CN(CC=C)C(=O)[C@@H]1CC(C)(C)C |
| InChI | InChI=1S/C16H27NO/c1-6-8-9-13-12-17(10-7-2)15(18)14(13)11-16(3,4)5/h6-7,13-14H,1-2,8-12H2,3-5H3/t13-,14+/m0/s1 |
| InChIKey | TZQYKSRZVMUDIN-UONOGXRCSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|