C13H22O3 — CID 102446786
(2R,3E,5E)-1-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-3,5-dien-2-ol (PubChem CID 102446786) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2R,3E,5E)-1-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-3,5-dien-2-ol.
| Compound Name | (2R,3E,5E)-1-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 102446786 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2R,3E,5E)-1-[(4R)-2,2-dimethyl-1,3-dioxan-4-yl]hepta-3,5-dien-2-ol |
| SMILES | C/C=C/C=C/[C@H](O)C[C@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C13H22O3/c1-4-5-6-7-11(14)10-12-8-9-15-13(2,3)16-12/h4-7,11-12,14H,8-10H2,1-3H3/b5-4+,7-6+/t11-,12+/m0/s1 |
| InChIKey | UUUCRLDAYDWAIV-YGIKINFHSA-N |
| XLogP | 2.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|